C18H13Cl3N4O — CID 6187957
2-chloro-N-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 6187957) has the molecular formula C18H13Cl3N4O and a molecular weight of 407.69 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6187957 |
| Molecular Formula | C18H13Cl3N4O |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-chloro-N-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1/C=N\NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H13Cl3N4O/c1-11-15(10-22-23-18(26)14-7-2-3-8-16(14)20)17(21)25(24-11)13-6-4-5-12(19)9-13/h2-10H,1H3,(H,23,26)/b22-10- |
| InChIKey | ZCXKVHRRAQXAJH-YVNNLAQVSA-N |
| XLogP | 4.90 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|