C18H21Cl2N5S — CID 3881259
1-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea (PubChem CID 3881259) has the molecular formula C18H21Cl2N5S and a molecular weight of 410.37 g/mol. Its IUPAC name is 1-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea.
| Compound Name | 1-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 3881259 |
| Molecular Formula | C18H21Cl2N5S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-[[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-3-cyclohexylthiourea |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1C=NNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C18H21Cl2N5S/c1-12-16(11-21-23-18(26)22-14-7-3-2-4-8-14)17(20)25(24-12)15-9-5-6-13(19)10-15/h5-6,9-11,14H,2-4,7-8H2,1H3,(H2,22,23,26) |
| InChIKey | LKTZPMJBCUVUIK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|