C18H19ClF3N5OS — CID 5188351
1-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 5188351) has the molecular formula C18H19ClF3N5OS and a molecular weight of 445.90 g/mol. Its IUPAC name is 1-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 5188351 |
| Molecular Formula | C18H19ClF3N5OS |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 1-[[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c(Cl)c1C=NNC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C18H19ClF3N5OS/c1-11-15(10-24-25-17(29)23-9-14-6-3-7-28-14)16(19)27(26-11)13-5-2-4-12(8-13)18(20,21)22/h2,4-5,8,10,14H,3,6-7,9H2,1H3,(H2,23,25,29) |
| InChIKey | KVQKPKXHCFQZLF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|