C14H19N3OS2 — CID 3956090
1-[(4-methylsulfanylphenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3956090) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(4-methylsulfanylphenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3956090 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | CSc1ccc(C=NNC(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H19N3OS2/c1-20-13-6-4-11(5-7-13)9-16-17-14(19)15-10-12-3-2-8-18-12/h4-7,9,12H,2-3,8,10H2,1H3,(H2,15,17,19) |
| InChIKey | LCQHNCWIVGECCB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|