C14H16F3N3OS — CID 18271462
1-(oxolan-2-ylmethyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 18271462) has the molecular formula C14H16F3N3OS and a molecular weight of 331.36 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 18271462 |
| Molecular Formula | C14H16F3N3OS |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | FC(F)(F)c1ccc(/C=N/NC(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H16F3N3OS/c15-14(16,17)11-5-3-10(4-6-11)8-19-20-13(22)18-9-12-2-1-7-21-12/h3-6,8,12H,1-2,7,9H2,(H2,18,20,22)/b19-8+ |
| InChIKey | KJYYMKZFBOTEQZ-UFWORHAWSA-N |
| XLogP | 2.68 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|