C15H14ClF3N4O2 — CID 6902840
ethyl N-[(E)-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]carbamate (PubChem CID 6902840) has the molecular formula C15H14ClF3N4O2 and a molecular weight of 374.75 g/mol. Its IUPAC name is ethyl N-[(E)-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]carbamate.
| Compound Name | ethyl N-[(E)-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6902840 |
| Molecular Formula | C15H14ClF3N4O2 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | ethyl N-[(E)-[5-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C/c1c(C)nn(-c2cccc(C(F)(F)F)c2)c1Cl |
| InChI | InChI=1S/C15H14ClF3N4O2/c1-3-25-14(24)21-20-8-12-9(2)22-23(13(12)16)11-6-4-5-10(7-11)15(17,18)19/h4-8H,3H2,1-2H3,(H,21,24)/b20-8+ |
| InChIKey | BAHOCGYQGSJGMK-DNTJNYDQSA-N |
| XLogP | 3.93 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|