C14H13F3N2O2 — CID 46743357
ethyl 5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate (PubChem CID 46743357) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is ethyl 5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46743357 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethyl 5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-3-21-13(20)12-7-9(2)18-19(12)11-6-4-5-10(8-11)14(15,16)17/h4-8H,3H2,1-2H3 |
| InChIKey | RNZTUVYTJLEZPT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |