C14H14F3N3O2 — CID 134397104
ethyl 5-methyl-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-3-carboxylate (PubChem CID 134397104) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is ethyl 5-methyl-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134397104 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | ethyl 5-methyl-2-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)nn1-c1cc(C(F)(F)F)cc(C)n1 |
| InChI | InChI=1S/C14H14F3N3O2/c1-4-22-13(21)11-6-9(3)19-20(11)12-7-10(14(15,16)17)5-8(2)18-12/h5-7H,4H2,1-3H3 |
| InChIKey | HAAMQNJXSTVAAF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |