C18H19F3N2O3 — CID 71568556
ethyl 5-(2-methyl-4-oxobutan-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate (PubChem CID 71568556) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is ethyl 5-(2-methyl-4-oxobutan-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(2-methyl-4-oxobutan-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71568556 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | ethyl 5-(2-methyl-4-oxobutan-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(C(F)(F)F)c2)c1C(C)(C)CC=O |
| InChI | InChI=1S/C18H19F3N2O3/c1-4-26-16(25)14-11-22-23(15(14)17(2,3)8-9-24)13-7-5-6-12(10-13)18(19,20)21/h5-7,9-11H,4,8H2,1-3H3 |
| InChIKey | RXBNXNWBNUNKBT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|