C14H12F3N3O3 — CID 168653430
ethyl 1-(4-formamidophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 168653430) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is ethyl 1-(4-formamidophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(4-formamidophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 168653430 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | ethyl 1-(4-formamidophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(NC=O)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C14H12F3N3O3/c1-2-23-13(22)11-7-19-20(12(11)14(15,16)17)10-5-3-9(4-6-10)18-8-21/h3-8H,2H2,1H3,(H,18,21) |
| InChIKey | ZNNWAHCZQBEGBF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|