C15H15F3N4O3 — CID 119293966
ethyl 1-[4-[(2-aminoacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 119293966) has the molecular formula C15H15F3N4O3 and a molecular weight of 356.30 g/mol. Its IUPAC name is ethyl 1-[4-[(2-aminoacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[(2-aminoacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 119293966 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | ethyl 1-[4-[(2-aminoacetyl)amino]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(NC(=O)CN)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O3/c1-2-25-14(24)11-8-20-22(13(11)15(16,17)18)10-5-3-9(4-6-10)21-12(23)7-19/h3-6,8H,2,7,19H2,1H3,(H,21,23) |
| InChIKey | TXFNRIUUNMQWLH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |