C20H15F4N3O3 — CID 52583500
ethyl 1-[4-[(4-fluorophenyl)carbamoyl]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 52583500) has the molecular formula C20H15F4N3O3 and a molecular weight of 421.35 g/mol. Its IUPAC name is ethyl 1-[4-[(4-fluorophenyl)carbamoyl]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[(4-fluorophenyl)carbamoyl]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 52583500 |
| Molecular Formula | C20H15F4N3O3 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | ethyl 1-[4-[(4-fluorophenyl)carbamoyl]phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)Nc3ccc(F)cc3)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C20H15F4N3O3/c1-2-30-19(29)16-11-25-27(17(16)20(22,23)24)15-9-3-12(4-10-15)18(28)26-14-7-5-13(21)6-8-14/h3-11H,2H2,1H3,(H,26,28) |
| InChIKey | UTCXZBBEWUIVLE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |