C19H20F6N4O3 — CID 52778135
tert-butyl N-[2-[[5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]ethyl]carbamate (PubChem CID 52778135) has the molecular formula C19H20F6N4O3 and a molecular weight of 466.38 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 52778135 |
| Molecular Formula | C19H20F6N4O3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | tert-butyl N-[2-[[5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cnn(-c2cccc(C(F)(F)F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C19H20F6N4O3/c1-17(2,3)32-16(31)27-8-7-26-15(30)13-10-28-29(14(13)19(23,24)25)12-6-4-5-11(9-12)18(20,21)22/h4-6,9-10H,7-8H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | MIASHVJIWYTHBT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|