C17H18ClF3N4O2 — CID 33123277
1-(3-chlorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 33123277) has the molecular formula C17H18ClF3N4O2 and a molecular weight of 402.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 33123277 |
| Molecular Formula | C17H18ClF3N4O2 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-(2-methylpropanoylamino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CC(C)C(=O)NCCNC(=O)c1cnn(-c2cccc(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C17H18ClF3N4O2/c1-10(2)15(26)22-6-7-23-16(27)13-9-24-25(14(13)17(19,20)21)12-5-3-4-11(18)8-12/h3-5,8-10H,6-7H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | MTJTYTWZDSHJMS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|