C20H15ClF3N3O4 — CID 55747639
N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(3-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55747639) has the molecular formula C20H15ClF3N3O4 and a molecular weight of 453.80 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(3-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(3-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55747639 |
| Molecular Formula | C20H15ClF3N3O4 |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yloxy)ethyl]-1-(3-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc2c(c1)OCO2)c1cnn(-c2cccc(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C20H15ClF3N3O4/c21-12-2-1-3-13(8-12)27-18(20(22,23)24)15(10-26-27)19(28)25-6-7-29-14-4-5-16-17(9-14)31-11-30-16/h1-5,8-10H,6-7,11H2,(H,25,28) |
| InChIKey | PKHQEPKXSCFBAB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|