C14H15F3N4O — CID 119384459
N-(2-aminoethyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 119384459) has the molecular formula C14H15F3N4O and a molecular weight of 312.30 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119384459 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(2-aminoethyl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N4O/c1-9-12(13(22)19-6-5-18)8-20-21(9)11-4-2-3-10(7-11)14(15,16)17/h2-4,7-8H,5-6,18H2,1H3,(H,19,22) |
| InChIKey | DVKXZKRVUXVPET-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |