C22H29F3N4O — CID 55716702
5-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 55716702) has the molecular formula C22H29F3N4O and a molecular weight of 422.50 g/mol. Its IUPAC name is 5-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55716702 |
| Molecular Formula | C22H29F3N4O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 5-methyl-N-[4-(4-methylpiperidin-1-yl)butyl]-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCN2CCC(C)CC2)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H29F3N4O/c1-16-8-12-28(13-9-16)11-4-3-10-26-21(30)20-15-27-29(17(20)2)19-7-5-6-18(14-19)22(23,24)25/h5-7,14-16H,3-4,8-13H2,1-2H3,(H,26,30) |
| InChIKey | TXHVSDNQFZUUHS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|