C15H17F3N4O — CID 120506039
N-[(2S)-1-aminopropan-2-yl]-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 120506039) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 120506039 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N[C@@H](C)CN)cnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N4O/c1-9(7-19)21-14(23)13-8-20-22(10(13)2)12-5-3-4-11(6-12)15(16,17)18/h3-6,8-9H,7,19H2,1-2H3,(H,21,23)/t9-/m0/s1 |
| InChIKey | DQPRPYUZJODZHC-VIFPVBQESA-N |
| XLogP | 2.28 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |