C20H14F6N4O2 — CID 46541102
N'-(2-methylbenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide (PubChem CID 46541102) has the molecular formula C20H14F6N4O2 and a molecular weight of 456.35 g/mol. Its IUPAC name is N'-(2-methylbenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide.
| Compound Name | N'-(2-methylbenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46541102 |
| Molecular Formula | C20H14F6N4O2 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N'-(2-methylbenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)c1cnn(-c2cccc(C(F)(F)F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C20H14F6N4O2/c1-11-5-2-3-8-14(11)17(31)28-29-18(32)15-10-27-30(16(15)20(24,25)26)13-7-4-6-12(9-13)19(21,22)23/h2-10H,1H3,(H,28,31)(H,29,32) |
| InChIKey | JHBZDZLWZFEJAI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|