C19H11ClF6N4O2 — CID 24663557
N'-(4-chlorobenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide (PubChem CID 24663557) has the molecular formula C19H11ClF6N4O2 and a molecular weight of 476.76 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24663557 |
| Molecular Formula | C19H11ClF6N4O2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | N'-(4-chlorobenzoyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cnn(-c2cccc(C(F)(F)F)c2)c1C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H11ClF6N4O2/c20-12-6-4-10(5-7-12)16(31)28-29-17(32)14-9-27-30(15(14)19(24,25)26)13-3-1-2-11(8-13)18(21,22)23/h1-9H,(H,28,31)(H,29,32) |
| InChIKey | SCCCNDOWPPOLBI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|