C19H14ClF3N4O2 — CID 55454920
1-(4-chlorophenyl)-N'-(2-methylbenzoyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide (PubChem CID 55454920) has the molecular formula C19H14ClF3N4O2 and a molecular weight of 422.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N'-(2-methylbenzoyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-(4-chlorophenyl)-N'-(2-methylbenzoyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55454920 |
| Molecular Formula | C19H14ClF3N4O2 |
| Molecular Weight | 422.79 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N'-(2-methylbenzoyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1ccccc1C(=O)NNC(=O)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3N4O2/c1-11-4-2-3-5-14(11)17(28)25-26-18(29)15-10-24-27(16(15)19(21,22)23)13-8-6-12(20)7-9-13/h2-10H,1H3,(H,25,28)(H,26,29) |
| InChIKey | KCYSYKAHDSJUSF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.79 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|