C13H12ClF3N4O — CID 122135515
N-(2-aminoethyl)-1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 122135515) has the molecular formula C13H12ClF3N4O and a molecular weight of 332.71 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122135515 |
| Molecular Formula | C13H12ClF3N4O |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | NCCNC(=O)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C13H12ClF3N4O/c14-8-1-3-9(4-2-8)21-11(13(15,16)17)10(7-20-21)12(22)19-6-5-18/h1-4,7H,5-6,18H2,(H,19,22) |
| InChIKey | WUMLMJWOUJBUAX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |