C19H14ClF4N3O — CID 31810667
N-[2-(4-chlorophenyl)ethyl]-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 31810667) has the molecular formula C19H14ClF4N3O and a molecular weight of 411.79 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31810667 |
| Molecular Formula | C19H14ClF4N3O |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1-(4-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1cnn(-c2ccc(F)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF4N3O/c20-13-3-1-12(2-4-13)9-10-25-18(28)16-11-26-27(17(16)19(22,23)24)15-7-5-14(21)6-8-15/h1-8,11H,9-10H2,(H,25,28) |
| InChIKey | PQRWGRWIFUBDQG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |