C18H22ClF3N4O — CID 55675778
1-(4-chlorophenyl)-N-[2-(diethylamino)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 55675778) has the molecular formula C18H22ClF3N4O and a molecular weight of 402.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-(diethylamino)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-(diethylamino)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55675778 |
| Molecular Formula | C18H22ClF3N4O |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-(diethylamino)propyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCN(CC)C(C)CNC(=O)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C18H22ClF3N4O/c1-4-25(5-2)12(3)10-23-17(27)15-11-24-26(16(15)18(20,21)22)14-8-6-13(19)7-9-14/h6-9,11-12H,4-5,10H2,1-3H3,(H,23,27) |
| InChIKey | RPBMGXLBKYJATN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |