C17H10ClF4N3O — CID 18228961
1-(4-chlorophenyl)-N-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 18228961) has the molecular formula C17H10ClF4N3O and a molecular weight of 383.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18228961 |
| Molecular Formula | C17H10ClF4N3O |
| Molecular Weight | 383.73 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H10ClF4N3O/c18-10-4-6-13(7-5-10)25-15(17(20,21)22)14(9-23-25)16(26)24-12-3-1-2-11(19)8-12/h1-9H,(H,24,26) |
| InChIKey | GUZWEAPMTPGPCW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |