C18H13ClF3N3O2 — CID 46827913
1-(4-chlorophenyl)-N-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 46827913) has the molecular formula C18H13ClF3N3O2 and a molecular weight of 395.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46827913 |
| Molecular Formula | C18H13ClF3N3O2 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-methoxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cnn(-c3ccc(Cl)cc3)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13ClF3N3O2/c1-27-14-4-2-3-12(9-14)24-17(26)15-10-23-25(16(15)18(20,21)22)13-7-5-11(19)6-8-13/h2-10H,1H3,(H,24,26) |
| InChIKey | AFQNOCLOBBNDRO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |