C17H12BClF3N3O3 — CID 58866199
[3-[[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]phenyl]boronic acid (PubChem CID 58866199) has the molecular formula C17H12BClF3N3O3 and a molecular weight of 409.56 g/mol. Its IUPAC name is [3-[[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]phenyl]boronic acid.
| Compound Name | [3-[[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 58866199 |
| Molecular Formula | C17H12BClF3N3O3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | [3-[[1-(4-chlorophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]amino]phenyl]boronic acid |
| SMILES | O=C(Nc1cccc(B(O)O)c1)c1cnn(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H12BClF3N3O3/c19-11-4-6-13(7-5-11)25-15(17(20,21)22)14(9-23-25)16(26)24-12-3-1-2-10(8-12)18(27)28/h1-9,27-28H,(H,24,26) |
| InChIKey | ZGBUQGAHGHBZSN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|