C17H10F6N4O — CID 32699923
N-pyridin-2-yl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 32699923) has the molecular formula C17H10F6N4O and a molecular weight of 400.28 g/mol. Its IUPAC name is N-pyridin-2-yl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-pyridin-2-yl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 32699923 |
| Molecular Formula | C17H10F6N4O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-pyridin-2-yl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccccn1)c1cnn(-c2cccc(C(F)(F)F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C17H10F6N4O/c18-16(19,20)10-4-3-5-11(8-10)27-14(17(21,22)23)12(9-25-27)15(28)26-13-6-1-2-7-24-13/h1-9H,(H,24,26,28) |
| InChIKey | SQMMQESDSDCPKR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |