C20H15F6N3O — CID 31808268
N-(4-ethylphenyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 31808268) has the molecular formula C20H15F6N3O and a molecular weight of 427.35 g/mol. Its IUPAC name is N-(4-ethylphenyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 31808268 |
| Molecular Formula | C20H15F6N3O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-(4-ethylphenyl)-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2cnn(-c3cccc(C(F)(F)F)c3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F6N3O/c1-2-12-6-8-14(9-7-12)28-18(30)16-11-27-29(17(16)20(24,25)26)15-5-3-4-13(10-15)19(21,22)23/h3-11H,2H2,1H3,(H,28,30) |
| InChIKey | RAELFGTYAACWIZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |