C17H10ClF3IN3O — CID 46635513
1-(3-chlorophenyl)-N-(4-iodophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 46635513) has the molecular formula C17H10ClF3IN3O and a molecular weight of 491.64 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(4-iodophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(4-iodophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46635513 |
| Molecular Formula | C17H10ClF3IN3O |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 490.95 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(4-iodophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1cnn(-c2cccc(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C17H10ClF3IN3O/c18-10-2-1-3-13(8-10)25-15(17(19,20)21)14(9-23-25)16(26)24-12-6-4-11(22)5-7-12/h1-9H,(H,24,26) |
| InChIKey | WWSSWLWMFUOAAN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|