C19H13F6N3O — CID 25470234
N-benzyl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 25470234) has the molecular formula C19H13F6N3O and a molecular weight of 413.32 g/mol. Its IUPAC name is N-benzyl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-benzyl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25470234 |
| Molecular Formula | C19H13F6N3O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-benzyl-5-(trifluoromethyl)-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cnn(-c2cccc(C(F)(F)F)c2)c1C(F)(F)F |
| InChI | InChI=1S/C19H13F6N3O/c20-18(21,22)13-7-4-8-14(9-13)28-16(19(23,24)25)15(11-27-28)17(29)26-10-12-5-2-1-3-6-12/h1-9,11H,10H2,(H,26,29) |
| InChIKey | DTXBWEXMCUZOEC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |