C17H14ClF3N6O — CID 33199188
1-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide (PubChem CID 33199188) has the molecular formula C17H14ClF3N6O and a molecular weight of 410.79 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 33199188 |
| Molecular Formula | C17H14ClF3N6O |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)c2cnn(-c3cccc(Cl)c3)c2C(F)(F)F)n1 |
| InChI | InChI=1S/C17H14ClF3N6O/c1-9-6-10(2)24-16(23-9)26-25-15(28)13-8-22-27(14(13)17(19,20)21)12-5-3-4-11(18)7-12/h3-8H,1-2H3,(H,25,28)(H,23,24,26) |
| InChIKey | ZGRVIBJVRYPCCN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|