C17H20ClN5OS — CID 4856078
1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 4856078) has the molecular formula C17H20ClN5OS and a molecular weight of 377.90 g/mol. Its IUPAC name is 1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4856078 |
| Molecular Formula | C17H20ClN5OS |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NNC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C17H20ClN5OS/c1-12-15(16(18)23(22-12)13-6-3-2-4-7-13)11-20-21-17(25)19-10-14-8-5-9-24-14/h2-4,6-7,11,14H,5,8-10H2,1H3,(H2,19,21,25) |
| InChIKey | RLEPKUZOBBXJGH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|