C23H25N5OS — CID 9410457
1-[(Z)-(1-benzyl-3-phenylpyrazol-4-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 9410457) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-[(Z)-(1-benzyl-3-phenylpyrazol-4-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(Z)-(1-benzyl-3-phenylpyrazol-4-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 9410457 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-[(Z)-(1-benzyl-3-phenylpyrazol-4-yl)methylideneamino]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | S=C(NC[C@@H]1CCCO1)N/N=C\c1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H25N5OS/c30-23(24-15-21-12-7-13-29-21)26-25-14-20-17-28(16-18-8-3-1-4-9-18)27-22(20)19-10-5-2-6-11-19/h1-6,8-11,14,17,21H,7,12-13,15-16H2,(H2,24,26,30)/b25-14-/t21-/m0/s1 |
| InChIKey | KLIKWLXVTHOAAK-RWFYVVHNSA-N |
| XLogP | 3.58 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|