C18H24N4OS — CID 19342670
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 19342670) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19342670 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C18H24N4OS/c1-13-17(20-18(24)19-11-16-9-6-10-23-16)14(2)22(21-13)12-15-7-4-3-5-8-15/h3-5,7-8,16H,6,9-12H2,1-2H3,(H2,19,20,24) |
| InChIKey | SPYSXKPKXSFAAT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|