C18H24N4S — CID 19677960
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-cyclopentylthiourea (PubChem CID 19677960) has the molecular formula C18H24N4S and a molecular weight of 328.48 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-cyclopentylthiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 19677960 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-cyclopentylthiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)NC1CCCC1 |
| InChI | InChI=1S/C18H24N4S/c1-13-17(20-18(23)19-16-10-6-7-11-16)14(2)22(21-13)12-15-8-4-3-5-9-15/h3-5,8-9,16H,6-7,10-12H2,1-2H3,(H2,19,20,23) |
| InChIKey | SRVIQBGKLXXJDB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|