C25H27FN6S — CID 19343544
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19343544) has the molecular formula C25H27FN6S and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19343544 |
| Molecular Formula | C25H27FN6S |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(3-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)Nc1c(C)nn(Cc2cccc(F)c2)c1C |
| InChI | InChI=1S/C25H27FN6S/c1-16-23(18(3)31(29-16)14-20-9-6-5-7-10-20)27-25(33)28-24-17(2)30-32(19(24)4)15-21-11-8-12-22(26)13-21/h5-13H,14-15H2,1-4H3,(H2,27,28,33) |
| InChIKey | CUXJSWZKQGPOHR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|