C20H19F3N4S — CID 17379489
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 17379489) has the molecular formula C20H19F3N4S and a molecular weight of 404.46 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17379489 |
| Molecular Formula | C20H19F3N4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N4S/c1-13-18(14(2)27(26-13)12-15-7-4-3-5-8-15)25-19(28)24-17-10-6-9-16(11-17)20(21,22)23/h3-11H,12H2,1-2H3,(H2,24,25,28) |
| InChIKey | KMWAGDYGUNAGST-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|