C26H26N4O2S — CID 19679493
1-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]-3-(3-methoxyphenyl)thiourea (PubChem CID 19679493) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 1-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19679493 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 1-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)Nc2c(C)nn(Cc3cccc(Oc4ccccc4)c3)c2C)c1 |
| InChI | InChI=1S/C26H26N4O2S/c1-18-25(28-26(33)27-21-10-8-13-23(16-21)31-3)19(2)30(29-18)17-20-9-7-14-24(15-20)32-22-11-5-4-6-12-22/h4-16H,17H2,1-3H3,(H2,27,28,33) |
| InChIKey | GPOKRDKXXXQNNL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|