C25H22Cl2N4OS — CID 19679507
1-(2,5-dichlorophenyl)-3-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19679507) has the molecular formula C25H22Cl2N4OS and a molecular weight of 497.45 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19679507 |
| Molecular Formula | C25H22Cl2N4OS |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[3,5-dimethyl-1-[(3-phenoxyphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2cccc(Oc3ccccc3)c2)c(C)c1NC(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H22Cl2N4OS/c1-16-24(29-25(33)28-23-14-19(26)11-12-22(23)27)17(2)31(30-16)15-18-7-6-10-21(13-18)32-20-8-4-3-5-9-20/h3-14H,15H2,1-2H3,(H2,28,29,33) |
| InChIKey | ATYPGEHRJTWUID-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|