C24H24Cl2N6S — CID 19403636
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea (PubChem CID 19403636) has the molecular formula C24H24Cl2N6S and a molecular weight of 499.47 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19403636 |
| Molecular Formula | C24H24Cl2N6S |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]-5-methylpyrazol-3-yl]thiourea |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=S)Nc1cc(C)n(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C24H24Cl2N6S/c1-15-11-22(30-31(15)14-19-9-10-20(25)12-21(19)26)27-24(33)28-23-16(2)29-32(17(23)3)13-18-7-5-4-6-8-18/h4-12H,13-14H2,1-3H3,(H2,27,28,30,33) |
| InChIKey | WPXZACWZUSJFQU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|