C22H19Cl3N6S — CID 19403561
1-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19403561) has the molecular formula C22H19Cl3N6S and a molecular weight of 505.86 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19403561 |
| Molecular Formula | C22H19Cl3N6S |
| Molecular Weight | 505.86 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]-5-methylpyrazol-3-yl]-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1cc(NC(=S)Nc2cnn(Cc3ccc(Cl)cc3Cl)c2)nn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H19Cl3N6S/c1-14-7-21(29-31(14)11-15-3-2-4-17(23)8-15)28-22(32)27-19-10-26-30(13-19)12-16-5-6-18(24)9-20(16)25/h2-10,13H,11-12H2,1H3,(H2,27,28,29,32) |
| InChIKey | XKFPSSZGFHULKO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.86 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|