C21H18Cl2N6S — CID 19397386
1-(1-benzylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19397386) has the molecular formula C21H18Cl2N6S and a molecular weight of 457.39 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19397386 |
| Molecular Formula | C21H18Cl2N6S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-3-[1-[(2,4-dichlorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | S=C(Nc1cnn(Cc2ccccc2)c1)Nc1ccn(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C21H18Cl2N6S/c22-17-7-6-16(19(23)10-17)13-28-9-8-20(27-28)26-21(30)25-18-11-24-29(14-18)12-15-4-2-1-3-5-15/h1-11,14H,12-13H2,(H2,25,26,27,30) |
| InChIKey | FFGVCOXINZBYAJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|