C20H21ClN8S — CID 19445864
1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445864) has the molecular formula C20H21ClN8S and a molecular weight of 440.96 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445864 |
| Molecular Formula | C20H21ClN8S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCn1cc(Cn2cc(NC(=S)Nc3ccn(Cc4ccccc4Cl)n3)cn2)cn1 |
| InChI | InChI=1S/C20H21ClN8S/c1-2-27-11-15(9-22-27)12-29-14-17(10-23-29)24-20(30)25-19-7-8-28(26-19)13-16-5-3-4-6-18(16)21/h3-11,14H,2,12-13H2,1H3,(H2,24,25,26,30) |
| InChIKey | WJUBYOGENCUGSH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|