C22H22N6S — CID 19395055
1-(1-benzylpyrazol-4-yl)-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19395055) has the molecular formula C22H22N6S and a molecular weight of 402.53 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19395055 |
| Molecular Formula | C22H22N6S |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1ccccc1Cn1ccc(NC(=S)Nc2cnn(Cc3ccccc3)c2)n1 |
| InChI | InChI=1S/C22H22N6S/c1-17-7-5-6-10-19(17)15-27-12-11-21(26-27)25-22(29)24-20-13-23-28(16-20)14-18-8-3-2-4-9-18/h2-13,16H,14-15H2,1H3,(H2,24,25,26,29) |
| InChIKey | QLWMUEYCJYYSAW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|