C21H23ClN8S — CID 19401389
1-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19401389) has the molecular formula C21H23ClN8S and a molecular weight of 454.99 g/mol. Its IUPAC name is 1-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19401389 |
| Molecular Formula | C21H23ClN8S |
| Molecular Weight | 454.99 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-[1-[(3-chlorophenyl)methyl]pyrazol-3-yl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCn1ncc(Cn2cc(NC(=S)Nc3ccn(Cc4cccc(Cl)c4)n3)cn2)c1C |
| InChI | InChI=1S/C21H23ClN8S/c1-3-30-15(2)17(10-24-30)13-29-14-19(11-23-29)25-21(31)26-20-7-8-28(27-20)12-16-5-4-6-18(22)9-16/h4-11,14H,3,12-13H2,1-2H3,(H2,25,26,27,31) |
| InChIKey | WSQPVEIHEMJFCE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.99 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|