C17H18Cl2N6S — CID 19445884
1-(2,5-dichlorophenyl)-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445884) has the molecular formula C17H18Cl2N6S and a molecular weight of 409.35 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445884 |
| Molecular Formula | C17H18Cl2N6S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCn1ncc(Cn2cc(NC(=S)Nc3cc(Cl)ccc3Cl)cn2)c1C |
| InChI | InChI=1S/C17H18Cl2N6S/c1-3-25-11(2)12(7-21-25)9-24-10-14(8-20-24)22-17(26)23-16-6-13(18)4-5-15(16)19/h4-8,10H,3,9H2,1-2H3,(H2,22,23,26) |
| InChIKey | DJBPPFOKYZQXEA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|