C22H26N8S — CID 19344054
1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19344054) has the molecular formula C22H26N8S and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19344054 |
| Molecular Formula | C22H26N8S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]-3-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCn1ncc(Cn2cc(NC(=S)Nc3cnn(Cc4cccc(C)c4)c3)cn2)c1C |
| InChI | InChI=1S/C22H26N8S/c1-4-30-17(3)19(9-25-30)13-29-15-21(11-24-29)27-22(31)26-20-10-23-28(14-20)12-18-7-5-6-16(2)8-18/h5-11,14-15H,4,12-13H2,1-3H3,(H2,26,27,31) |
| InChIKey | YWARCVZYZBAPFA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|