C18H31N7S — CID 19445881
1-[3-(diethylamino)propyl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19445881) has the molecular formula C18H31N7S and a molecular weight of 377.56 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445881 |
| Molecular Formula | C18H31N7S |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1cnn(Cc2cnn(CC)c2C)c1 |
| InChI | InChI=1S/C18H31N7S/c1-5-23(6-2)10-8-9-19-18(26)22-17-12-20-24(14-17)13-16-11-21-25(7-3)15(16)4/h11-12,14H,5-10,13H2,1-4H3,(H2,19,22,26) |
| InChIKey | DKWFENDTWRKVCZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|