C18H26FN5S — CID 19342509
1-[3-(diethylamino)propyl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19342509) has the molecular formula C18H26FN5S and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19342509 |
| Molecular Formula | C18H26FN5S |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1cnn(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H26FN5S/c1-3-23(4-2)11-5-10-20-18(25)22-17-12-21-24(14-17)13-15-6-8-16(19)9-7-15/h6-9,12,14H,3-5,10-11,13H2,1-2H3,(H2,20,22,25) |
| InChIKey | JWYCOEGBVQNWAI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|